C22H24N2O4S — CID 2476710
tert-butyl (4R,5S)-4-[5-(4-acetylphenyl)furan-2-yl]-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate (PubChem CID 2476710) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is tert-butyl (4R,5S)-4-[5-(4-acetylphenyl)furan-2-yl]-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate.
| Compound Name | tert-butyl (4R,5S)-4-[5-(4-acetylphenyl)furan-2-yl]-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2476710 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | tert-butyl (4R,5S)-4-[5-(4-acetylphenyl)furan-2-yl]-6-methylidene-2-sulfanylidene-1,3-diazinane-5-carboxylate |
| SMILES | C=C1NC(=S)N[C@@H](c2ccc(-c3ccc(C(C)=O)cc3)o2)[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H24N2O4S/c1-12-18(20(26)28-22(3,4)5)19(24-21(29)23-12)17-11-10-16(27-17)15-8-6-14(7-9-15)13(2)25/h6-11,18-19H,1H2,2-5H3,(H2,23,24,29)/t18-,19+/m1/s1 |
| InChIKey | YNGKAETULKRRNI-MOPGFXCFSA-N |
| XLogP | 4.14 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|