C44H51N2OP — CID 24767228
cyclohexyl-[(4S,5S)-2-(1-dicyclohexylphosphanylnaphthalen-2-yl)-4,5-diphenyl-4,5-dihydroimidazol-1-yl]methanone (PubChem CID 24767228) has the molecular formula C44H51N2OP and a molecular weight of 654.88 g/mol. Its IUPAC name is cyclohexyl-[(4S,5S)-2-(1-dicyclohexylphosphanylnaphthalen-2-yl)-4,5-diphenyl-4,5-dihydroimidazol-1-yl]methanone.
| Compound Name | cyclohexyl-[(4S,5S)-2-(1-dicyclohexylphosphanylnaphthalen-2-yl)-4,5-diphenyl-4,5-dihydroimidazol-1-yl]methanone |
|---|---|
| PubChem CID | 24767228 |
| Molecular Formula | C44H51N2OP |
| Molecular Weight | 654.88 g/mol |
| Exact Mass | 654.37 |
| IUPAC Name | cyclohexyl-[(4S,5S)-2-(1-dicyclohexylphosphanylnaphthalen-2-yl)-4,5-diphenyl-4,5-dihydroimidazol-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1C(c2ccc3ccccc3c2P(C2CCCCC2)C2CCCCC2)=N[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C44H51N2OP/c47-44(35-23-10-3-11-24-35)46-41(34-21-8-2-9-22-34)40(33-19-6-1-7-20-33)45-43(46)39-31-30-32-18-16-17-29-38(32)42(39)48(36-25-12-4-13-26-36)37-27-14-5-15-28-37/h1-2,6-9,16-22,29-31,35-37,40-41H,3-5,10-15,23-28H2/t40-,41-/m0/s1 |
| InChIKey | RYZKXFXTLDKUCS-YATWDLPUSA-N |
| XLogP | 11.26 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.88 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|