C12H14O3 — CID 24767237
prop-2-enyl (3aR,6aS)-2-oxo-3,3a,4,6a-tetrahydro-1H-pentalene-1-carboxylate (PubChem CID 24767237) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is prop-2-enyl (3aR,6aS)-2-oxo-3,3a,4,6a-tetrahydro-1H-pentalene-1-carboxylate.
| Compound Name | prop-2-enyl (3aR,6aS)-2-oxo-3,3a,4,6a-tetrahydro-1H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 24767237 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | prop-2-enyl (3aR,6aS)-2-oxo-3,3a,4,6a-tetrahydro-1H-pentalene-1-carboxylate |
| SMILES | C=CCOC(=O)C1C(=O)C[C@H]2CC=C[C@@H]12 |
| InChI | InChI=1S/C12H14O3/c1-2-6-15-12(14)11-9-5-3-4-8(9)7-10(11)13/h2-3,5,8-9,11H,1,4,6-7H2/t8-,9-,11?/m1/s1 |
| InChIKey | SVIHEKORECUOOX-RUZZIDMASA-N |
| XLogP | 1.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|