C15H11N3O6S — CID 24767348
2-(4-nitrophenyl)sulfonyl-3,5-dihydro-2,3-benzodiazepine-1,4-dione (PubChem CID 24767348) has the molecular formula C15H11N3O6S and a molecular weight of 361.34 g/mol. Its IUPAC name is 2-(4-nitrophenyl)sulfonyl-3,5-dihydro-2,3-benzodiazepine-1,4-dione.
| Compound Name | 2-(4-nitrophenyl)sulfonyl-3,5-dihydro-2,3-benzodiazepine-1,4-dione |
|---|---|
| PubChem CID | 24767348 |
| Molecular Formula | C15H11N3O6S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-(4-nitrophenyl)sulfonyl-3,5-dihydro-2,3-benzodiazepine-1,4-dione |
| SMILES | O=C1Cc2ccccc2C(=O)N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C15H11N3O6S/c19-14-9-10-3-1-2-4-13(10)15(20)17(16-14)25(23,24)12-7-5-11(6-8-12)18(21)22/h1-8H,9H2,(H,16,19) |
| InChIKey | PCYZWLDKGDSSJU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|