C12H18O3Si — CID 24767476
(1R,2R,6S,7S)-10-trimethylsilyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 24767476) has the molecular formula C12H18O3Si and a molecular weight of 238.36 g/mol. Its IUPAC name is (1R,2R,6S,7S)-10-trimethylsilyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6S,7S)-10-trimethylsilyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 24767476 |
| Molecular Formula | C12H18O3Si |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (1R,2R,6S,7S)-10-trimethylsilyl-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C[Si](C)(C)C1[C@H]2CC[C@@H]1[C@@H]1C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C12H18O3Si/c1-16(2,3)10-6-4-5-7(10)9-8(6)11(13)15-12(9)14/h6-10H,4-5H2,1-3H3/t6-,7+,8+,9-,10? |
| InChIKey | MOVLCLCWEUBCKR-ZGHGJDBCSA-N |
| XLogP | 2.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|