C12H20N2O6 — CID 24767601
(2R,3aR,7R,7aR)-2-[(2S)-2-amino-2-carboxyethyl]-7-(methylamino)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylic acid (PubChem CID 24767601) has the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. Its IUPAC name is (2R,3aR,7R,7aR)-2-[(2S)-2-amino-2-carboxyethyl]-7-(methylamino)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylic acid.
| Compound Name | (2R,3aR,7R,7aR)-2-[(2S)-2-amino-2-carboxyethyl]-7-(methylamino)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylic acid |
|---|---|
| PubChem CID | 24767601 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (2R,3aR,7R,7aR)-2-[(2S)-2-amino-2-carboxyethyl]-7-(methylamino)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylic acid |
| SMILES | CN[C@@H]1CCO[C@@H]2C[C@](C[C@H](N)C(=O)O)(C(=O)O)O[C@H]12 |
| InChI | InChI=1S/C12H20N2O6/c1-14-7-2-3-19-8-5-12(11(17)18,20-9(7)8)4-6(13)10(15)16/h6-9,14H,2-5,13H2,1H3,(H,15,16)(H,17,18)/t6-,7+,8+,9+,12+/m0/s1 |
| InChIKey | YRYQVYMEPAZMHT-HRYDXZTJSA-N |
| XLogP | -1.22 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |