C16H34O4Si — CID 24767664
(2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethyloctanoic acid (PubChem CID 24767664) has the molecular formula C16H34O4Si and a molecular weight of 318.53 g/mol. Its IUPAC name is (2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethyloctanoic acid.
| Compound Name | (2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethyloctanoic acid |
|---|---|
| PubChem CID | 24767664 |
| Molecular Formula | C16H34O4Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethyloctanoic acid |
| SMILES | C[C@H](CCO)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C16H34O4Si/c1-12(10-11-17)8-9-14(13(2)15(18)19)20-21(6,7)16(3,4)5/h12-14,17H,8-11H2,1-7H3,(H,18,19)/t12-,13+,14-/m0/s1 |
| InChIKey | LDOIADWDPGWSID-MJBXVCDLSA-N |
| XLogP | 3.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|