C25H20F7NO3 — CID 24767817
4-ethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine (PubChem CID 24767817) has the molecular formula C25H20F7NO3 and a molecular weight of 515.43 g/mol. Its IUPAC name is 4-ethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-ethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 24767817 |
| Molecular Formula | C25H20F7NO3 |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 4-ethyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine |
| SMILES | CCN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OCC1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C25H20F7NO3/c1-2-33-20-11-5-10-19(15-6-3-9-18(12-15)36-25(30,31)32)22(20)34-14-21(33)16-7-4-8-17(13-16)35-24(28,29)23(26)27/h3-13,21,23H,2,14H2,1H3 |
| InChIKey | WGMBJQOPUJXELM-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|