C26H22F7NO3 — CID 24767818
4-propyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine (PubChem CID 24767818) has the molecular formula C26H22F7NO3 and a molecular weight of 529.45 g/mol. Its IUPAC name is 4-propyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-propyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 24767818 |
| Molecular Formula | C26H22F7NO3 |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 4-propyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine |
| SMILES | CCCN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OCC1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C26H22F7NO3/c1-2-12-34-21-11-5-10-20(16-6-3-9-19(13-16)37-26(31,32)33)23(21)35-15-22(34)17-7-4-8-18(14-17)36-25(29,30)24(27)28/h3-11,13-14,22,24H,2,12,15H2,1H3 |
| InChIKey | UZNICJDFQNTYNC-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|