C25H19F8NO3 — CID 24767824
1,1,1-trifluoro-3-[8-(3-fluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol (PubChem CID 24767824) has the molecular formula C25H19F8NO3 and a molecular weight of 533.42 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[8-(3-fluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[8-(3-fluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 24767824 |
| Molecular Formula | C25H19F8NO3 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 1,1,1-trifluoro-3-[8-(3-fluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
| SMILES | OC(CN1c2cccc(-c3cccc(F)c3)c2OCC1c1cccc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C25H19F8NO3/c26-16-6-1-4-14(10-16)18-8-3-9-19-22(18)36-13-20(34(19)12-21(35)24(29,30)31)15-5-2-7-17(11-15)37-25(32,33)23(27)28/h1-11,20-21,23,35H,12-13H2 |
| InChIKey | IGJUBSQVEFLKIU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|