C27H18F13NO3 — CID 24767828
(2S)-3-[(3S)-8-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 24767828) has the molecular formula C27H18F13NO3 and a molecular weight of 651.42 g/mol. Its IUPAC name is (2S)-3-[(3S)-8-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-3-[(3S)-8-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 24767828 |
| Molecular Formula | C27H18F13NO3 |
| Molecular Weight | 651.42 g/mol |
| Exact Mass | 651.11 |
| IUPAC Name | (2S)-3-[(3S)-8-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@@H](CN1c2cccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2OC[C@@H]1c1cccc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C27H18F13NO3/c28-23(29)27(39,40)44-17-4-1-3-13(9-17)20-12-43-22-18(5-2-6-19(22)41(20)11-21(42)26(36,37)38)14-7-15(24(30,31)32)10-16(8-14)25(33,34)35/h1-10,20-21,23,42H,11-12H2/t20-,21+/m1/s1 |
| InChIKey | QRLRYADUYDBIBX-RTWAWAEBSA-N |
| XLogP | 8.49 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.42 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|