C25H17F8NO5 — CID 24767841
3-[3-(2,2-difluoro-1,3-benzodioxol-5-yl)-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 24767841) has the molecular formula C25H17F8NO5 and a molecular weight of 563.40 g/mol. Its IUPAC name is 3-[3-(2,2-difluoro-1,3-benzodioxol-5-yl)-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[3-(2,2-difluoro-1,3-benzodioxol-5-yl)-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 24767841 |
| Molecular Formula | C25H17F8NO5 |
| Molecular Weight | 563.40 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | 3-[3-(2,2-difluoro-1,3-benzodioxol-5-yl)-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OCC1c1ccc2c(c1)OC(F)(F)O2)C(F)(F)F |
| InChI | InChI=1S/C25H17F8NO5/c26-23(27,28)21(35)11-34-17-6-2-5-16(13-3-1-4-15(9-13)37-24(29,30)31)22(17)36-12-18(34)14-7-8-19-20(10-14)39-25(32,33)38-19/h1-10,18,21,35H,11-12H2 |
| InChIKey | JGCBAFOVBJKFAV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.40 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |