C26H22F7NO4 — CID 24767843
4-(2-methoxyethyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine (PubChem CID 24767843) has the molecular formula C26H22F7NO4 and a molecular weight of 545.45 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-(2-methoxyethyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 24767843 |
| Molecular Formula | C26H22F7NO4 |
| Molecular Weight | 545.45 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 4-(2-methoxyethyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine |
| SMILES | COCCN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OCC1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C26H22F7NO4/c1-35-12-11-34-21-10-4-9-20(16-5-2-8-19(13-16)38-26(31,32)33)23(21)36-15-22(34)17-6-3-7-18(14-17)37-25(29,30)24(27)28/h2-10,13-14,22,24H,11-12,15H2,1H3 |
| InChIKey | CMGDKEDNIBWNJC-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.45 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|