C26H21F8NO4 — CID 24767857
(2R)-1-fluoro-3-[(3S)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol (PubChem CID 24767857) has the molecular formula C26H21F8NO4 and a molecular weight of 563.44 g/mol. Its IUPAC name is (2R)-1-fluoro-3-[(3S)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol.
| Compound Name | (2R)-1-fluoro-3-[(3S)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 24767857 |
| Molecular Formula | C26H21F8NO4 |
| Molecular Weight | 563.44 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | (2R)-1-fluoro-3-[(3S)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
| SMILES | O[C@@H](CF)CN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OC[C@@H]1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C26H21F8NO4/c27-12-17(36)13-35-21-9-3-8-20(15-4-1-7-19(10-15)39-26(32,33)34)23(21)37-14-22(35)16-5-2-6-18(11-16)38-25(30,31)24(28)29/h1-11,17,22,24,36H,12-14H2/t17-,22+/m0/s1 |
| InChIKey | FKJJMMKURBBIHS-HTAPYJJXSA-N |
| XLogP | 6.76 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.44 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|