C27H25F7N2O3 — CID 24767863
N,N-dimethyl-2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanamine (PubChem CID 24767863) has the molecular formula C27H25F7N2O3 and a molecular weight of 558.49 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanamine |
|---|---|
| PubChem CID | 24767863 |
| Molecular Formula | C27H25F7N2O3 |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | N,N-dimethyl-2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethanamine |
| SMILES | CN(C)CCN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OCC1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C27H25F7N2O3/c1-35(2)12-13-36-22-11-5-10-21(17-6-3-9-20(14-17)39-27(32,33)34)24(22)37-16-23(36)18-7-4-8-19(15-18)38-26(30,31)25(28)29/h3-11,14-15,23,25H,12-13,16H2,1-2H3 |
| InChIKey | LXWNJEHYGRSICU-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|