C27H24F7NO4 — CID 24767872
2-methyl-1-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol (PubChem CID 24767872) has the molecular formula C27H24F7NO4 and a molecular weight of 559.48 g/mol. Its IUPAC name is 2-methyl-1-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol.
| Compound Name | 2-methyl-1-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 24767872 |
| Molecular Formula | C27H24F7NO4 |
| Molecular Weight | 559.48 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 2-methyl-1-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
| SMILES | CC(C)(O)CN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OCC1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C27H24F7NO4/c1-25(2,36)15-35-21-11-5-10-20(16-6-3-9-19(12-16)39-27(32,33)34)23(21)37-14-22(35)17-7-4-8-18(13-17)38-26(30,31)24(28)29/h3-13,22,24,36H,14-15H2,1-2H3 |
| InChIKey | KBKVJQZJTBJJNV-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.48 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|