C25H18F9NO3 — CID 24767892
(2S)-3-[(3S)-8-(3,5-difluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 24767892) has the molecular formula C25H18F9NO3 and a molecular weight of 551.41 g/mol. Its IUPAC name is (2S)-3-[(3S)-8-(3,5-difluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-3-[(3S)-8-(3,5-difluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 24767892 |
| Molecular Formula | C25H18F9NO3 |
| Molecular Weight | 551.41 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | (2S)-3-[(3S)-8-(3,5-difluorophenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@@H](CN1c2cccc(-c3cc(F)cc(F)c3)c2OC[C@@H]1c1cccc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C25H18F9NO3/c26-15-7-14(8-16(27)10-15)18-5-2-6-19-22(18)37-12-20(35(19)11-21(36)24(30,31)32)13-3-1-4-17(9-13)38-25(33,34)23(28)29/h1-10,20-21,23,36H,11-12H2/t20-,21+/m1/s1 |
| InChIKey | HFLMLMQGYJQWFT-RTWAWAEBSA-N |
| XLogP | 6.73 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.41 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|