C24H16F9NO3 — CID 24767903
(2S)-1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol (PubChem CID 24767903) has the molecular formula C24H16F9NO3 and a molecular weight of 537.38 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 24767903 |
| Molecular Formula | C24H16F9NO3 |
| Molecular Weight | 537.38 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | (2S)-1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
| SMILES | O[C@@H](CN1c2cccc(-c3cc(F)c(F)c(F)c3)c2OC[C@@H]1c1cccc(OC(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C24H16F9NO3/c25-16-8-13(9-17(26)21(16)27)15-5-2-6-18-22(15)36-11-19(34(18)10-20(35)23(28,29)30)12-3-1-4-14(7-12)37-24(31,32)33/h1-9,19-20,35H,10-11H2/t19-,20+/m1/s1 |
| InChIKey | LFZMQMDJIJUMCR-UXHICEINSA-N |
| XLogP | 6.53 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.38 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|