C26H34N8O — CID 24767906
2-N-butyl-6-N-[2-(2-methoxyphenyl)ethyl]-2-N-methyl-4-N-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 24767906) has the molecular formula C26H34N8O and a molecular weight of 474.61 g/mol. Its IUPAC name is 2-N-butyl-6-N-[2-(2-methoxyphenyl)ethyl]-2-N-methyl-4-N-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-butyl-6-N-[2-(2-methoxyphenyl)ethyl]-2-N-methyl-4-N-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 24767906 |
| Molecular Formula | C26H34N8O |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | 2-N-butyl-6-N-[2-(2-methoxyphenyl)ethyl]-2-N-methyl-4-N-[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(C)c1nc(NCCc2ccccc2OC)nc(NCCc2c[nH]c3ncccc23)n1 |
| InChI | InChI=1S/C26H34N8O/c1-4-5-17-34(2)26-32-24(28-15-12-19-9-6-7-11-22(19)35-3)31-25(33-26)29-16-13-20-18-30-23-21(20)10-8-14-27-23/h6-11,14,18H,4-5,12-13,15-17H2,1-3H3,(H,27,30)(H2,28,29,31,32,33) |
| InChIKey | VQXIMOSNRRZCHV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |