C28H26FN7O2 — CID 24767909
2-N-(3,4-dimethoxyphenyl)-6-N-[2-(2-fluorophenyl)ethyl]-4-N-quinolin-6-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 24767909) has the molecular formula C28H26FN7O2 and a molecular weight of 511.56 g/mol. Its IUPAC name is 2-N-(3,4-dimethoxyphenyl)-6-N-[2-(2-fluorophenyl)ethyl]-4-N-quinolin-6-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(3,4-dimethoxyphenyl)-6-N-[2-(2-fluorophenyl)ethyl]-4-N-quinolin-6-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 24767909 |
| Molecular Formula | C28H26FN7O2 |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-N-(3,4-dimethoxyphenyl)-6-N-[2-(2-fluorophenyl)ethyl]-4-N-quinolin-6-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(Nc2nc(NCCc3ccccc3F)nc(Nc3ccc4ncccc4c3)n2)cc1OC |
| InChI | InChI=1S/C28H26FN7O2/c1-37-24-12-10-21(17-25(24)38-2)33-28-35-26(31-15-13-18-6-3-4-8-22(18)29)34-27(36-28)32-20-9-11-23-19(16-20)7-5-14-30-23/h3-12,14,16-17H,13,15H2,1-2H3,(H3,31,32,33,34,35,36) |
| InChIKey | FLCQZZIDGSESAD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |