C27H19N7O4 — CID 24768058
4-[3-(4-aminophenyl)-6-(6-amino-1,2,4-triazin-3-yl)-5-(4-carboxyphenyl)pyrazin-2-yl]benzoic acid (PubChem CID 24768058) has the molecular formula C27H19N7O4 and a molecular weight of 505.49 g/mol. Its IUPAC name is 4-[3-(4-aminophenyl)-6-(6-amino-1,2,4-triazin-3-yl)-5-(4-carboxyphenyl)pyrazin-2-yl]benzoic acid.
| Compound Name | 4-[3-(4-aminophenyl)-6-(6-amino-1,2,4-triazin-3-yl)-5-(4-carboxyphenyl)pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 24768058 |
| Molecular Formula | C27H19N7O4 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 4-[3-(4-aminophenyl)-6-(6-amino-1,2,4-triazin-3-yl)-5-(4-carboxyphenyl)pyrazin-2-yl]benzoic acid |
| SMILES | Nc1ccc(-c2nc(-c3ccc(C(=O)O)cc3)c(-c3ncc(N)nn3)nc2-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H19N7O4/c28-19-11-9-16(10-12-19)21-22(14-1-5-17(6-2-14)26(35)36)32-24(25-30-13-20(29)33-34-25)23(31-21)15-3-7-18(8-4-15)27(37)38/h1-13H,28H2,(H2,29,33)(H,35,36)(H,37,38) |
| InChIKey | XFSMKAFRZXJUNQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 191.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|