C23H18N2O2 — CID 24768116
3-anilino-1-benzyl-4-phenylpyrrole-2,5-dione (PubChem CID 24768116) has the molecular formula C23H18N2O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-anilino-1-benzyl-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-anilino-1-benzyl-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 24768116 |
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-anilino-1-benzyl-4-phenylpyrrole-2,5-dione |
| SMILES | O=C1C(Nc2ccccc2)=C(c2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H18N2O2/c26-22-20(18-12-6-2-7-13-18)21(24-19-14-8-3-9-15-19)23(27)25(22)16-17-10-4-1-5-11-17/h1-15,24H,16H2 |
| InChIKey | GLDDBILAEOMQJI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|