C15H12N4OS — CID 24768279
1-phenyl-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)urea (PubChem CID 24768279) has the molecular formula C15H12N4OS and a molecular weight of 296.36 g/mol. Its IUPAC name is 1-phenyl-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-phenyl-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 24768279 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1-phenyl-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)urea |
| SMILES | O=C(Nc1ccccc1)Nc1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C15H12N4OS/c20-15(17-12-4-2-1-3-5-12)19-13-10-21-14(18-13)11-6-8-16-9-7-11/h1-10H,(H2,17,19,20) |
| InChIKey | AXDWPTZOIRLDDO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |