About 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one
4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one (PubChem CID 24768330) has the molecular formula C21H29N5O2
and a molecular weight of 383.50 g/mol. Its IUPAC name is 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one.
Molecular Properties
| Compound Name | 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one |
| PubChem CID | 24768330 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one |
| SMILES | CCCCN(CC)c1nc(C)nc2c1NC(=O)CN2c1ccc(OC)cc1C |
| InChI | InChI=1S/C21H29N5O2/c1-6-8-11-25(7-2)20-19-21(23-15(4)22-20)26(13-18(27)24-19)17-10-9-16(28-5)12-14(17)3/h9-10,12H,6-8,11,13H2,1-5H3,(H,24,27) |
| InChIKey | GBZINFFYVNYYJL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one?
The IUPAC name of 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one (CID 24768330) is 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one.
What is the SMILES notation for 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one?
The canonical SMILES for 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one is CCCCN(CC)c1nc(C)nc2c1NC(=O)CN2c1ccc(OC)cc1C.
What is the InChIKey of 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one?
The InChIKey is GBZINFFYVNYYJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N5O2/c1-6-8-11-25(7-2)20-19-21(23-15(4)22-20)26(13-18(27)24-19)17-10-9-16(28-5)12-14(17)3/h9-10,12H,6-8,11,13H2,1-5H3,(H,24,27).
What are the key properties of 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one?
4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one has a molecular weight of 383.50 g/mol, XLogP of 3.82, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[butyl(ethyl)amino]-8-(4-methoxy-2-methylphenyl)-2-methyl-5,7-dihydropteridin-6-one is sourced from PubChem (CID 24768330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).