About 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole
1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole (PubChem CID 24768399) has the molecular formula C17H12Cl4N2O
and a molecular weight of 402.11 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole.
Molecular Properties
| Compound Name | 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole |
| PubChem CID | 24768399 |
| Molecular Formula | C17H12Cl4N2O |
| Molecular Weight | 402.11 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole |
| SMILES | Clc1ccc(OC(Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl4N2O/c18-11-1-3-13(14(20)7-11)17(9-23-6-5-22-10-23)24-16-4-2-12(19)8-15(16)21/h1-8,10,17H,9H2 |
| InChIKey | ZSEJKLXYMYILHA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.11 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole?
The IUPAC name of 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole (CID 24768399) is 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole.
What is the SMILES notation for 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole?
The canonical SMILES for 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole is Clc1ccc(OC(Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1.
What is the InChIKey of 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole?
The InChIKey is ZSEJKLXYMYILHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl4N2O/c18-11-1-3-13(14(20)7-11)17(9-23-6-5-22-10-23)24-16-4-2-12(19)8-15(16)21/h1-8,10,17H,9H2.
What are the key properties of 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole?
1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole has a molecular weight of 402.11 g/mol, XLogP of 6.32, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,4-dichlorophenoxy)-2-(2,4-dichlorophenyl)ethyl]imidazole is sourced from PubChem (CID 24768399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).