About N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide
N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide (PubChem CID 24768448) has the molecular formula C16H17Cl2N3O2S
and a molecular weight of 386.30 g/mol. Its IUPAC name is N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide |
| PubChem CID | 24768448 |
| Molecular Formula | C16H17Cl2N3O2S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide |
| SMILES | CCCSc1nc(NC(C)=O)cc(OCc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C16H17Cl2N3O2S/c1-3-6-24-16-20-14(19-10(2)22)8-15(21-16)23-9-11-4-5-12(17)7-13(11)18/h4-5,7-8H,3,6,9H2,1-2H3,(H,19,20,21,22) |
| InChIKey | ALKHYYXDOUGTKZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide?
The IUPAC name of N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide (CID 24768448) is N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide.
What is the SMILES notation for N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide?
The canonical SMILES for N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide is CCCSc1nc(NC(C)=O)cc(OCc2ccc(Cl)cc2Cl)n1.
What is the InChIKey of N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide?
The InChIKey is ALKHYYXDOUGTKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2N3O2S/c1-3-6-24-16-20-14(19-10(2)22)8-15(21-16)23-9-11-4-5-12(17)7-13(11)18/h4-5,7-8H,3,6,9H2,1-2H3,(H,19,20,21,22).
What are the key properties of N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide?
N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide has a molecular weight of 386.30 g/mol, XLogP of 4.82, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-[(2,4-dichlorophenyl)methoxy]-2-propylsulfanylpyrimidin-4-yl]acetamide is sourced from PubChem (CID 24768448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).