C22H25F4NO2 — CID 24768488
[4,5,6,7-tetrafluoro-1-(oxan-4-ylmethyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone (PubChem CID 24768488) has the molecular formula C22H25F4NO2 and a molecular weight of 411.44 g/mol. Its IUPAC name is [4,5,6,7-tetrafluoro-1-(oxan-4-ylmethyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone.
| Compound Name | [4,5,6,7-tetrafluoro-1-(oxan-4-ylmethyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 24768488 |
| Molecular Formula | C22H25F4NO2 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [4,5,6,7-tetrafluoro-1-(oxan-4-ylmethyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
| SMILES | CC1(C)C(C(=O)c2cn(CC3CCOCC3)c3c(F)c(F)c(F)c(F)c23)C1(C)C |
| InChI | InChI=1S/C22H25F4NO2/c1-21(2)20(22(21,3)4)19(28)12-10-27(9-11-5-7-29-8-6-11)18-13(12)14(23)15(24)16(25)17(18)26/h10-11,20H,5-9H2,1-4H3 |
| InChIKey | QZLZVRDMGYFIQN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|