C18H19FN2O2S — CID 24768515
2-[3-(3-fluorophenyl)sulfonylindol-1-yl]-N,N-dimethylethanamine (PubChem CID 24768515) has the molecular formula C18H19FN2O2S and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[3-(3-fluorophenyl)sulfonylindol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[3-(3-fluorophenyl)sulfonylindol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 24768515 |
| Molecular Formula | C18H19FN2O2S |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-[3-(3-fluorophenyl)sulfonylindol-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1cc(S(=O)(=O)c2cccc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C18H19FN2O2S/c1-20(2)10-11-21-13-18(16-8-3-4-9-17(16)21)24(22,23)15-7-5-6-14(19)12-15/h3-9,12-13H,10-11H2,1-2H3 |
| InChIKey | JOERYDWTJHBWAH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |