C30H43N3O — CID 24768519
6-[4-(2-tert-butylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide (PubChem CID 24768519) has the molecular formula C30H43N3O and a molecular weight of 461.69 g/mol. Its IUPAC name is 6-[4-(2-tert-butylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide.
| Compound Name | 6-[4-(2-tert-butylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide |
|---|---|
| PubChem CID | 24768519 |
| Molecular Formula | C30H43N3O |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.34 |
| IUPAC Name | 6-[4-(2-tert-butylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide |
| SMILES | CC(C)(C)c1ccccc1N1CCN(CCCCCC(=O)NC2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C30H43N3O/c1-30(2,3)26-15-8-9-17-28(26)33-22-20-32(21-23-33)19-10-4-5-18-29(34)31-27-16-11-13-24-12-6-7-14-25(24)27/h6-9,12,14-15,17,27H,4-5,10-11,13,16,18-23H2,1-3H3,(H,31,34) |
| InChIKey | BLCHSWWAUDRFLL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|