C27H38N4O3S — CID 24768523
6-[4-[2-(methanesulfonamido)phenyl]piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide (PubChem CID 24768523) has the molecular formula C27H38N4O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is 6-[4-[2-(methanesulfonamido)phenyl]piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide.
| Compound Name | 6-[4-[2-(methanesulfonamido)phenyl]piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide |
|---|---|
| PubChem CID | 24768523 |
| Molecular Formula | C27H38N4O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 6-[4-[2-(methanesulfonamido)phenyl]piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide |
| SMILES | CS(=O)(=O)Nc1ccccc1N1CCN(CCCCCC(=O)NC2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C27H38N4O3S/c1-35(33,34)29-25-13-6-7-15-26(25)31-20-18-30(19-21-31)17-8-2-3-16-27(32)28-24-14-9-11-22-10-4-5-12-23(22)24/h4-7,10,12-13,15,24,29H,2-3,8-9,11,14,16-21H2,1H3,(H,28,32) |
| InChIKey | PUVLRPJSGDJKOF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|