C20H21N7O2S — CID 24768576
(NZ)-N-[[4-[7-[(3-methyl-1,2-thiazol-5-yl)amino]-5-piperidin-3-ylpyrazolo[1,5-a]pyrimidin-3-yl]furan-2-yl]methylidene]hydroxylamine (PubChem CID 24768576) has the molecular formula C20H21N7O2S and a molecular weight of 423.50 g/mol. Its IUPAC name is (NZ)-N-[[4-[7-[(3-methyl-1,2-thiazol-5-yl)amino]-5-piperidin-3-ylpyrazolo[1,5-a]pyrimidin-3-yl]furan-2-yl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[4-[7-[(3-methyl-1,2-thiazol-5-yl)amino]-5-piperidin-3-ylpyrazolo[1,5-a]pyrimidin-3-yl]furan-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 24768576 |
| Molecular Formula | C20H21N7O2S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (NZ)-N-[[4-[7-[(3-methyl-1,2-thiazol-5-yl)amino]-5-piperidin-3-ylpyrazolo[1,5-a]pyrimidin-3-yl]furan-2-yl]methylidene]hydroxylamine |
| SMILES | Cc1cc(Nc2cc(C3CCCNC3)nc3c(-c4coc(/C=N\O)c4)cnn23)sn1 |
| InChI | InChI=1S/C20H21N7O2S/c1-12-5-19(30-26-12)25-18-7-17(13-3-2-4-21-8-13)24-20-16(10-22-27(18)20)14-6-15(9-23-28)29-11-14/h5-7,9-11,13,21,25,28H,2-4,8H2,1H3/b23-9- |
| InChIKey | IWMSDLVCXQZSEZ-AQHIEDMUSA-N |
| XLogP | 3.77 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|