C20H22N4O3 — CID 24769112
10-[3-[hydroxy(dimethyl)azaniumyl]propylamino]-15-methyl-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-olate (PubChem CID 24769112) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 10-[3-[hydroxy(dimethyl)azaniumyl]propylamino]-15-methyl-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-olate.
| Compound Name | 10-[3-[hydroxy(dimethyl)azaniumyl]propylamino]-15-methyl-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-olate |
|---|---|
| PubChem CID | 24769112 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 10-[3-[hydroxy(dimethyl)azaniumyl]propylamino]-15-methyl-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-5-olate |
| SMILES | Cc1nc2ccc(NCCC[N+](C)(C)O)c3c(=O)c4cc([O-])ccc4n1c23 |
| InChI | InChI=1S/C20H22N4O3/c1-12-22-16-7-6-15(21-9-4-10-24(2,3)27)18-19(16)23(12)17-8-5-13(25)11-14(17)20(18)26/h5-8,11,27H,4,9-10H2,1-3H3,(H-,21,25,26) |
| InChIKey | SKOQDKRBMBXSKX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 89.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|