C16H15NO8 — CID 24769158
[(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate (PubChem CID 24769158) has the molecular formula C16H15NO8 and a molecular weight of 349.30 g/mol. Its IUPAC name is [(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate.
| Compound Name | [(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate |
|---|---|
| PubChem CID | 24769158 |
| Molecular Formula | C16H15NO8 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | [(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C2c3cc4c(c(O)c3C(=O)N[C@H]2[C@H](O)[C@@H]1O)OCO4 |
| InChI | InChI=1S/C16H15NO8/c1-5(18)25-8-3-7-6-2-9-15(24-4-23-9)13(20)10(6)16(22)17-11(7)14(21)12(8)19/h2-3,8,11-12,14,19-21H,4H2,1H3,(H,17,22)/t8-,11+,12+,14-/m0/s1 |
| InChIKey | APFGDAWZIPFINP-MBGOOHRESA-N |
| XLogP | -0.72 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |