C30H39NO6 — CID 24769658
1-[4-[4-[[2-cyclopropyl-5-[(1S,2S,3R,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]methyl]phenoxy]piperidin-1-yl]ethanone (PubChem CID 24769658) has the molecular formula C30H39NO6 and a molecular weight of 509.64 g/mol. Its IUPAC name is 1-[4-[4-[[2-cyclopropyl-5-[(1S,2S,3R,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]methyl]phenoxy]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[[2-cyclopropyl-5-[(1S,2S,3R,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]methyl]phenoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 24769658 |
| Molecular Formula | C30H39NO6 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 1-[4-[4-[[2-cyclopropyl-5-[(1S,2S,3R,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]phenyl]methyl]phenoxy]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(Oc2ccc(Cc3cc([C@@H]4C[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3C3CC3)cc2)CC1 |
| InChI | InChI=1S/C30H39NO6/c1-18(33)31-12-10-25(11-13-31)37-24-7-2-19(3-8-24)14-22-15-21(6-9-26(22)20-4-5-20)27-16-23(17-32)28(34)30(36)29(27)35/h2-3,6-9,15,20,23,25,27-30,32,34-36H,4-5,10-14,16-17H2,1H3/t23-,27+,28-,29+,30+/m1/s1 |
| InChIKey | CQTJXWBKBGUKCS-CNSBPHOCSA-N |
| XLogP | 2.72 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |