C21H18N4O3 — CID 24769779
N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide (PubChem CID 24769779) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 24769779 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2-c2nc3ncccc3[nH]2)cc1OC |
| InChI | InChI=1S/C21H18N4O3/c1-27-17-10-9-13(12-18(17)28-2)21(26)24-15-7-4-3-6-14(15)19-23-16-8-5-11-22-20(16)25-19/h3-12H,1-2H3,(H,24,26)(H,22,23,25) |
| InChIKey | OYANJGYHTCPKQL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |