About N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide
N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide (PubChem CID 24769779) has the molecular formula C21H18N4O3
and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide |
| PubChem CID | 24769779 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide |
| SMILES | COC1=C(C=C(C=C1)C(=O)NC2=CC=CC=C2C3=NC4=C(N3)C=CC=N4)OC |
| InChI | InChI=1S/C21H18N4O3/c1-27-17-10-9-13(12-18(17)28-2)21(26)24-15-7-4-3-6-14(15)19-23-16-8-5-11-22-20(16)25-19/h3-12H,1-2H3,(H,24,26)(H,22,23,25) |
| InChIKey | OYANJGYHTCPKQL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | 534 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide?
The IUPAC name of N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide (CID 24769779) is N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide.
What is the SMILES notation for N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide?
The canonical SMILES for N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide is COC1=C(C=C(C=C1)C(=O)NC2=CC=CC=C2C3=NC4=C(N3)C=CC=N4)OC.
What is the InChIKey of N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide?
The InChIKey is OYANJGYHTCPKQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O3/c1-27-17-10-9-13(12-18(17)28-2)21(26)24-15-7-4-3-6-14(15)19-23-16-8-5-11-22-20(16)25-19/h3-12H,1-2H3,(H,24,26)(H,22,23,25).
What are the key properties of N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide?
N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide has a molecular weight of 374.40 g/mol, XLogP of 3.40, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-3,4-dimethoxybenzamide is sourced from PubChem (CID 24769779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).