C23H22N2O3 — CID 24770003
(2S,3S,4R)-4-(4-methoxyphenyl)-3-methyl-6-nitro-2-phenyl-1,2,3,4-tetrahydroquinoline (PubChem CID 24770003) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is (2S,3S,4R)-4-(4-methoxyphenyl)-3-methyl-6-nitro-2-phenyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S,3S,4R)-4-(4-methoxyphenyl)-3-methyl-6-nitro-2-phenyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 24770003 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (2S,3S,4R)-4-(4-methoxyphenyl)-3-methyl-6-nitro-2-phenyl-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1ccc([C@@H]2c3cc([N+](=O)[O-])ccc3N[C@H](c3ccccc3)[C@H]2C)cc1 |
| InChI | InChI=1S/C23H22N2O3/c1-15-22(16-8-11-19(28-2)12-9-16)20-14-18(25(26)27)10-13-21(20)24-23(15)17-6-4-3-5-7-17/h3-15,22-24H,1-2H3/t15-,22+,23-/m0/s1 |
| InChIKey | IMXQHIQNAKWAOL-BJQRDSPESA-N |
| XLogP | 5.54 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|