C14H11BrO4 — CID 24770033
7-bromo-9,10-dihydrophenanthrene-2,3,5,6-tetrol (PubChem CID 24770033) has the molecular formula C14H11BrO4 and a molecular weight of 323.14 g/mol. Its IUPAC name is 7-bromo-9,10-dihydrophenanthrene-2,3,5,6-tetrol.
| Compound Name | 7-bromo-9,10-dihydrophenanthrene-2,3,5,6-tetrol |
|---|---|
| PubChem CID | 24770033 |
| Molecular Formula | C14H11BrO4 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 7-bromo-9,10-dihydrophenanthrene-2,3,5,6-tetrol |
| SMILES | Oc1cc2c(cc1O)-c1c(cc(Br)c(O)c1O)CC2 |
| InChI | InChI=1S/C14H11BrO4/c15-9-3-7-2-1-6-4-10(16)11(17)5-8(6)12(7)14(19)13(9)18/h3-5,16-19H,1-2H2 |
| InChIKey | UODFQZPQJAMFEV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|