C14H10Br2O4 — CID 24770034
4,7-dibromo-9,10-dihydrophenanthrene-2,3,5,6-tetrol (PubChem CID 24770034) has the molecular formula C14H10Br2O4 and a molecular weight of 402.04 g/mol. Its IUPAC name is 4,7-dibromo-9,10-dihydrophenanthrene-2,3,5,6-tetrol.
| Compound Name | 4,7-dibromo-9,10-dihydrophenanthrene-2,3,5,6-tetrol |
|---|---|
| PubChem CID | 24770034 |
| Molecular Formula | C14H10Br2O4 |
| Molecular Weight | 402.04 g/mol |
| Exact Mass | 399.89 |
| IUPAC Name | 4,7-dibromo-9,10-dihydrophenanthrene-2,3,5,6-tetrol |
| SMILES | Oc1cc2c(c(Br)c1O)-c1c(cc(Br)c(O)c1O)CC2 |
| InChI | InChI=1S/C14H10Br2O4/c15-7-3-5-1-2-6-4-8(17)13(19)11(16)9(6)10(5)14(20)12(7)18/h3-4,17-20H,1-2H2 |
| InChIKey | SSPNVSUGGPBPEK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.04 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|