C24H28N2O8 — CID 24770359
dimethyl (1R,2R,4S,9R,17S,18R,19R,22R)-18,19-dihydroxy-14-methoxy-3-oxa-6,16-diazaheptacyclo[15.2.2.11,6.02,4.09,17.010,15.09,22]docosa-10(15),11,13-triene-16,18-dicarboxylate (PubChem CID 24770359) has the molecular formula C24H28N2O8 and a molecular weight of 472.49 g/mol. Its IUPAC name is dimethyl (1R,2R,4S,9R,17S,18R,19R,22R)-18,19-dihydroxy-14-methoxy-3-oxa-6,16-diazaheptacyclo[15.2.2.11,6.02,4.09,17.010,15.09,22]docosa-10(15),11,13-triene-16,18-dicarboxylate.
| Compound Name | dimethyl (1R,2R,4S,9R,17S,18R,19R,22R)-18,19-dihydroxy-14-methoxy-3-oxa-6,16-diazaheptacyclo[15.2.2.11,6.02,4.09,17.010,15.09,22]docosa-10(15),11,13-triene-16,18-dicarboxylate |
|---|---|
| PubChem CID | 24770359 |
| Molecular Formula | C24H28N2O8 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | dimethyl (1R,2R,4S,9R,17S,18R,19R,22R)-18,19-dihydroxy-14-methoxy-3-oxa-6,16-diazaheptacyclo[15.2.2.11,6.02,4.09,17.010,15.09,22]docosa-10(15),11,13-triene-16,18-dicarboxylate |
| SMILES | COC(=O)N1c2c(OC)cccc2[C@@]23CCN4C[C@@H]5O[C@@H]5[C@]5(CC[C@]12[C@](O)(C(=O)OC)[C@@H]5O)[C@H]43 |
| InChI | InChI=1S/C24H28N2O8/c1-31-13-6-4-5-12-15(13)26(20(29)33-3)23-8-7-21(18(27)24(23,30)19(28)32-2)16-14(34-16)11-25-10-9-22(12,23)17(21)25/h4-6,14,16-18,27,30H,7-11H2,1-3H3/t14-,16-,17-,18+,21+,22+,23-,24+/m0/s1 |
| InChIKey | YYNNLSNHGLNXCW-AAAXAGHWSA-N |
| XLogP | 0.17 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|