C12H15N2O5PS — CID 24770594
[5-[2-amino-5-(2,2-dimethylpropanoyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid (PubChem CID 24770594) has the molecular formula C12H15N2O5PS and a molecular weight of 330.30 g/mol. Its IUPAC name is [5-[2-amino-5-(2,2-dimethylpropanoyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid.
| Compound Name | [5-[2-amino-5-(2,2-dimethylpropanoyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 24770594 |
| Molecular Formula | C12H15N2O5PS |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | [5-[2-amino-5-(2,2-dimethylpropanoyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid |
| SMILES | CC(C)(C)C(=O)c1sc(N)nc1-c1ccc(P(=O)(O)O)o1 |
| InChI | InChI=1S/C12H15N2O5PS/c1-12(2,3)10(15)9-8(14-11(13)21-9)6-4-5-7(19-6)20(16,17)18/h4-5H,1-3H3,(H2,13,14)(H2,16,17,18) |
| InChIKey | OQFMQCXGUUIUAO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|