C28H36O5 — CID 24770745
(1S,4S,6R,7S)-7-[(1E,3E,5E,7E,9E)-10-[(2S,3R,6R)-3-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl]undeca-1,3,5,7,9-pentaenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione (PubChem CID 24770745) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is (1S,4S,6R,7S)-7-[(1E,3E,5E,7E,9E)-10-[(2S,3R,6R)-3-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl]undeca-1,3,5,7,9-pentaenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione.
| Compound Name | (1S,4S,6R,7S)-7-[(1E,3E,5E,7E,9E)-10-[(2S,3R,6R)-3-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl]undeca-1,3,5,7,9-pentaenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
|---|---|
| PubChem CID | 24770745 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (1S,4S,6R,7S)-7-[(1E,3E,5E,7E,9E)-10-[(2S,3R,6R)-3-hydroxy-3,5,6-trimethyl-2,6-dihydropyran-2-yl]undeca-1,3,5,7,9-pentaenyl]-4,6,7-trimethyl-2-oxabicyclo[2.2.1]heptane-3,5-dione |
| SMILES | CC1=C[C@@](C)(O)[C@H](/C(C)=C/C=C/C=C/C=C/C=C/[C@]2(C)[C@H]3OC(=O)[C@]2(C)C(=O)[C@@H]3C)O[C@@H]1C |
| InChI | InChI=1S/C28H36O5/c1-18(23-27(6,31)17-19(2)21(4)32-23)15-13-11-9-8-10-12-14-16-26(5)24-20(3)22(29)28(26,7)25(30)33-24/h8-17,20-21,23-24,31H,1-7H3/b9-8+,12-10+,13-11+,16-14+,18-15+/t20-,21+,23-,24-,26+,27+,28-/m0/s1 |
| InChIKey | CVXQCMWFBBVLLA-AJRJFUNNSA-N |
| XLogP | 4.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|