C17H18FN3O2 — CID 24770965
1,4-diazepan-1-yl-[6-(4-fluorophenoxy)-3-pyridinyl]methanone (PubChem CID 24770965) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[6-(4-fluorophenoxy)-3-pyridinyl]methanone.
| Compound Name | 1,4-diazepan-1-yl-[6-(4-fluorophenoxy)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 24770965 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1,4-diazepan-1-yl-[6-(4-fluorophenoxy)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(Oc2ccc(F)cc2)nc1)N1CCCNCC1 |
| InChI | InChI=1S/C17H18FN3O2/c18-14-3-5-15(6-4-14)23-16-7-2-13(12-20-16)17(22)21-10-1-8-19-9-11-21/h2-7,12,19H,1,8-11H2 |
| InChIKey | DJBQOVQBHHGGBX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |