C29H32BrNO8 — CID 24771022
8-bromo-15-methoxy-6-methyl-7-propyl-17-oxa-6-azahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18(23),25-octaene-3,10,19,21,22,26-hexol (PubChem CID 24771022) has the molecular formula C29H32BrNO8 and a molecular weight of 602.48 g/mol. Its IUPAC name is 8-bromo-15-methoxy-6-methyl-7-propyl-17-oxa-6-azahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18(23),25-octaene-3,10,19,21,22,26-hexol.
| Compound Name | 8-bromo-15-methoxy-6-methyl-7-propyl-17-oxa-6-azahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18(23),25-octaene-3,10,19,21,22,26-hexol |
|---|---|
| PubChem CID | 24771022 |
| Molecular Formula | C29H32BrNO8 |
| Molecular Weight | 602.48 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | 8-bromo-15-methoxy-6-methyl-7-propyl-17-oxa-6-azahexacyclo[12.12.0.02,11.04,9.016,25.018,23]hexacosa-1(14),2(11),3,7,9,15,18(23),25-octaene-3,10,19,21,22,26-hexol |
| SMILES | CCCC1=C(Br)c2c(O)c3c(c(O)c2CN1C)-c1c(O)c2c(c(OC)c1CC3)OC1=C(C2)C(O)C(O)CC1O |
| InChI | InChI=1S/C29H32BrNO8/c1-4-5-16-22(30)21-15(10-31(16)2)26(37)19-11(24(21)35)6-7-12-20(19)25(36)14-8-13-23(34)17(32)9-18(33)27(13)39-29(14)28(12)38-3/h17-18,23,32-37H,4-10H2,1-3H3 |
| InChIKey | MQYXYOCBWBZATG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|