C12H11Cl2N5 — CID 24771276
6-(2,3-dichlorophenyl)-3-imino-2-prop-2-enyl-1,2,4-triazin-5-amine (PubChem CID 24771276) has the molecular formula C12H11Cl2N5 and a molecular weight of 296.16 g/mol. Its IUPAC name is 6-(2,3-dichlorophenyl)-3-imino-2-prop-2-enyl-1,2,4-triazin-5-amine.
| Compound Name | 6-(2,3-dichlorophenyl)-3-imino-2-prop-2-enyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 24771276 |
| Molecular Formula | C12H11Cl2N5 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 6-(2,3-dichlorophenyl)-3-imino-2-prop-2-enyl-1,2,4-triazin-5-amine |
| SMILES | [H]/N=c1\nc(N)c(-c2cccc(Cl)c2Cl)nn1CC=C |
| InChI | InChI=1S/C12H11Cl2N5/c1-2-6-19-12(16)17-11(15)10(18-19)7-4-3-5-8(13)9(7)14/h2-5H,1,6H2,(H3,15,16,17) |
| InChIKey | IYPICUONXQQCLF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|