About (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone
(4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone (PubChem CID 24771363) has the molecular formula C21H23Cl2N3O2
and a molecular weight of 420.34 g/mol. Its IUPAC name is (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone.
Molecular Properties
| Compound Name | (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone |
| PubChem CID | 24771363 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(Oc2ccc(Cl)c(Cl)c2)nc1)N1CCCN(C2CCC2)CC1 |
| InChI | InChI=1S/C21H23Cl2N3O2/c22-18-7-6-17(13-19(18)23)28-20-8-5-15(14-24-20)21(27)26-10-2-9-25(11-12-26)16-3-1-4-16/h5-8,13-14,16H,1-4,9-12H2 |
| InChIKey | HMNMEBGQBBJDKL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone?
The IUPAC name of (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone (CID 24771363) is (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone.
What is the SMILES notation for (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone?
The canonical SMILES for (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone is O=C(c1ccc(Oc2ccc(Cl)c(Cl)c2)nc1)N1CCCN(C2CCC2)CC1.
What is the InChIKey of (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone?
The InChIKey is HMNMEBGQBBJDKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23Cl2N3O2/c22-18-7-6-17(13-19(18)23)28-20-8-5-15(14-24-20)21(27)26-10-2-9-25(11-12-26)16-3-1-4-16/h5-8,13-14,16H,1-4,9-12H2.
What are the key properties of (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone?
(4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone has a molecular weight of 420.34 g/mol, XLogP of 4.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclobutyl-1,4-diazepan-1-yl)-[6-(3,4-dichlorophenoxy)-3-pyridinyl]methanone is sourced from PubChem (CID 24771363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).