C31H22N2O5 — CID 24771429
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-perylen-3-ylethynyl)pyrimidine-2,4-dione (PubChem CID 24771429) has the molecular formula C31H22N2O5 and a molecular weight of 502.53 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-perylen-3-ylethynyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-perylen-3-ylethynyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 24771429 |
| Molecular Formula | C31H22N2O5 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-perylen-3-ylethynyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1C#Cc1ccc2c3cccc4cccc(c5cccc1c52)c43 |
| InChI | InChI=1S/C31H22N2O5/c34-16-26-25(35)14-27(38-26)33-15-19(30(36)32-31(33)37)11-10-17-12-13-24-22-8-2-5-18-4-1-7-21(28(18)22)23-9-3-6-20(17)29(23)24/h1-9,12-13,15,25-27,34-35H,14,16H2,(H,32,36,37)/t25-,26+,27+/m0/s1 |
| InChIKey | RKXFQGZIGHUJCW-OYUWMTPXSA-N |
| XLogP | 3.63 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|