C20H21F3N4O3 — CID 24771503
N-(2-methoxyethyl)-5,7-dimethyl-6-[[3-(trifluoromethoxy)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 24771503) has the molecular formula C20H21F3N4O3 and a molecular weight of 422.41 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5,7-dimethyl-6-[[3-(trifluoromethoxy)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5,7-dimethyl-6-[[3-(trifluoromethoxy)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 24771503 |
| Molecular Formula | C20H21F3N4O3 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-(2-methoxyethyl)-5,7-dimethyl-6-[[3-(trifluoromethoxy)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COCCNC(=O)c1cnn2c(C)c(Cc3cccc(OC(F)(F)F)c3)c(C)nc12 |
| InChI | InChI=1S/C20H21F3N4O3/c1-12-16(10-14-5-4-6-15(9-14)30-20(21,22)23)13(2)27-18(26-12)17(11-25-27)19(28)24-7-8-29-3/h4-6,9,11H,7-8,10H2,1-3H3,(H,24,28) |
| InChIKey | DDGDXSVHBUIHMU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|