C19H20Cl2N4O2 — CID 24771504
6-[(2,5-dichlorophenyl)methyl]-N-(2-methoxyethyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 24771504) has the molecular formula C19H20Cl2N4O2 and a molecular weight of 407.30 g/mol. Its IUPAC name is 6-[(2,5-dichlorophenyl)methyl]-N-(2-methoxyethyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 6-[(2,5-dichlorophenyl)methyl]-N-(2-methoxyethyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 24771504 |
| Molecular Formula | C19H20Cl2N4O2 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 6-[(2,5-dichlorophenyl)methyl]-N-(2-methoxyethyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COCCNC(=O)c1cnn2c(C)c(Cc3cc(Cl)ccc3Cl)c(C)nc12 |
| InChI | InChI=1S/C19H20Cl2N4O2/c1-11-15(9-13-8-14(20)4-5-17(13)21)12(2)25-18(24-11)16(10-23-25)19(26)22-6-7-27-3/h4-5,8,10H,6-7,9H2,1-3H3,(H,22,26) |
| InChIKey | HQYICPHHHCJWCG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|