C26H25F3N4O3 — CID 24771553
5,7-dimethyl-N-(2-phenylmethoxyethyl)-6-[[3-(trifluoromethoxy)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 24771553) has the molecular formula C26H25F3N4O3 and a molecular weight of 498.51 g/mol. Its IUPAC name is 5,7-dimethyl-N-(2-phenylmethoxyethyl)-6-[[3-(trifluoromethoxy)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5,7-dimethyl-N-(2-phenylmethoxyethyl)-6-[[3-(trifluoromethoxy)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 24771553 |
| Molecular Formula | C26H25F3N4O3 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 5,7-dimethyl-N-(2-phenylmethoxyethyl)-6-[[3-(trifluoromethoxy)phenyl]methyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1nc2c(C(=O)NCCOCc3ccccc3)cnn2c(C)c1Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C26H25F3N4O3/c1-17-22(14-20-9-6-10-21(13-20)36-26(27,28)29)18(2)33-24(32-17)23(15-31-33)25(34)30-11-12-35-16-19-7-4-3-5-8-19/h3-10,13,15H,11-12,14,16H2,1-2H3,(H,30,34) |
| InChIKey | KQMRXHRQBXBGBI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|