C22H18N5O2+ — CID 24771761
7-methoxy-4-[(6-phenyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-3-yl)methoxy]quinoline (PubChem CID 24771761) has the molecular formula C22H18N5O2+ and a molecular weight of 384.42 g/mol. Its IUPAC name is 7-methoxy-4-[(6-phenyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-3-yl)methoxy]quinoline.
| Compound Name | 7-methoxy-4-[(6-phenyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-3-yl)methoxy]quinoline |
|---|---|
| PubChem CID | 24771761 |
| Molecular Formula | C22H18N5O2+ |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 7-methoxy-4-[(6-phenyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-3-yl)methoxy]quinoline |
| SMILES | COc1ccc2c(OCc3[nH]nc4ccc(-c5ccccc5)n[n+]34)ccnc2c1 |
| InChI | InChI=1S/C22H17N5O2/c1-28-16-7-8-17-19(13-16)23-12-11-20(17)29-14-22-25-24-21-10-9-18(26-27(21)22)15-5-3-2-4-6-15/h2-13H,14H2,1H3/p+1 |
| InChIKey | HEAIZQNMNCHNFD-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|